C12H11N3O4 — CID 61249007
N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)-3-oxobutanamide (PubChem CID 61249007) has the molecular formula C12H11N3O4 and a molecular weight of 261.24 g/mol. Its IUPAC name is N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)-3-oxobutanamide.
| Compound Name | N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)-3-oxobutanamide |
|---|---|
| PubChem CID | 61249007 |
| Molecular Formula | C12H11N3O4 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)-3-oxobutanamide |
| SMILES | CC(=O)CC(=O)Nc1ccc2[nH]c(=O)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C12H11N3O4/c1-6(16)4-10(17)13-7-2-3-8-9(5-7)15-12(19)11(18)14-8/h2-3,5H,4H2,1H3,(H,13,17)(H,14,18)(H,15,19) |
| InChIKey | TUARSDHCQUKTLV-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|