C11H9N3O5 — CID 62231775
3-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)amino]-3-oxopropanoic acid (PubChem CID 62231775) has the molecular formula C11H9N3O5 and a molecular weight of 263.21 g/mol. Its IUPAC name is 3-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)amino]-3-oxopropanoic acid.
| Compound Name | 3-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)amino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 62231775 |
| Molecular Formula | C11H9N3O5 |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 3-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)amino]-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)Nc1ccc2[nH]c(=O)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C11H9N3O5/c15-8(4-9(16)17)12-5-1-2-6-7(3-5)14-11(19)10(18)13-6/h1-3H,4H2,(H,12,15)(H,13,18)(H,14,19)(H,16,17) |
| InChIKey | HNCUICFMLLOHTG-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|