C13H14N4O3 — CID 115452525
1-(aminomethyl)-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)cyclopropane-1-carboxamide (PubChem CID 115452525) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is 1-(aminomethyl)-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)cyclopropane-1-carboxamide.
| Compound Name | 1-(aminomethyl)-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 115452525 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 1-(aminomethyl)-N-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)cyclopropane-1-carboxamide |
| SMILES | NCC1(C(=O)Nc2ccc3[nH]c(=O)c(=O)[nH]c3c2)CC1 |
| InChI | InChI=1S/C13H14N4O3/c14-6-13(3-4-13)12(20)15-7-1-2-8-9(5-7)17-11(19)10(18)16-8/h1-2,5H,3-4,6,14H2,(H,15,20)(H,16,18)(H,17,19) |
| InChIKey | NENWOHKWXDLBBY-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|