C19H23N7OS — CID 125433965
(3R)-N-[4-(4-methylpiperazin-1-yl)phenyl]-3-(tetrazol-1-yl)-3-thiophen-3-ylpropanamide (PubChem CID 125433965) has the molecular formula C19H23N7OS and a molecular weight of 397.51 g/mol. Its IUPAC name is (3R)-N-[4-(4-methylpiperazin-1-yl)phenyl]-3-(tetrazol-1-yl)-3-thiophen-3-ylpropanamide.
| Compound Name | (3R)-N-[4-(4-methylpiperazin-1-yl)phenyl]-3-(tetrazol-1-yl)-3-thiophen-3-ylpropanamide |
|---|---|
| PubChem CID | 125433965 |
| Molecular Formula | C19H23N7OS |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | (3R)-N-[4-(4-methylpiperazin-1-yl)phenyl]-3-(tetrazol-1-yl)-3-thiophen-3-ylpropanamide |
| SMILES | CN1CCN(c2ccc(NC(=O)C[C@H](c3ccsc3)n3cnnn3)cc2)CC1 |
| InChI | InChI=1S/C19H23N7OS/c1-24-7-9-25(10-8-24)17-4-2-16(3-5-17)21-19(27)12-18(15-6-11-28-13-15)26-14-20-22-23-26/h2-6,11,13-14,18H,7-10,12H2,1H3,(H,21,27)/t18-/m1/s1 |
| InChIKey | CAKNSCBOCVNZHH-GOSISDBHSA-N |
| XLogP | 2.10 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|