C19H26N4OS — CID 38925497
N-[4-(4-methylpiperazin-1-yl)phenyl]-2-(2-propan-2-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 38925497) has the molecular formula C19H26N4OS and a molecular weight of 358.51 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-2-(2-propan-2-yl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-2-(2-propan-2-yl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 38925497 |
| Molecular Formula | C19H26N4OS |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-2-(2-propan-2-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | CC(C)c1nc(CC(=O)Nc2ccc(N3CCN(C)CC3)cc2)cs1 |
| InChI | InChI=1S/C19H26N4OS/c1-14(2)19-21-16(13-25-19)12-18(24)20-15-4-6-17(7-5-15)23-10-8-22(3)9-11-23/h4-7,13-14H,8-12H2,1-3H3,(H,20,24) |
| InChIKey | IBKYIAGGOWAOHP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|