C21H31N7O — CID 121239339
N-[4-(4-methylpiperazin-1-yl)phenyl]-2-[1-(tetrazol-1-ylmethyl)cyclohexyl]acetamide (PubChem CID 121239339) has the molecular formula C21H31N7O and a molecular weight of 397.53 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-2-[1-(tetrazol-1-ylmethyl)cyclohexyl]acetamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-2-[1-(tetrazol-1-ylmethyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 121239339 |
| Molecular Formula | C21H31N7O |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-2-[1-(tetrazol-1-ylmethyl)cyclohexyl]acetamide |
| SMILES | CN1CCN(c2ccc(NC(=O)CC3(Cn4cnnn4)CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C21H31N7O/c1-26-11-13-27(14-12-26)19-7-5-18(6-8-19)23-20(29)15-21(9-3-2-4-10-21)16-28-17-22-24-25-28/h5-8,17H,2-4,9-16H2,1H3,(H,23,29) |
| InChIKey | IXPADQUXRBDNSA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|