C16H24N8O — CID 125431329
N-[2-(pyrimidin-2-ylamino)ethyl]-2-[1-(tetrazol-1-ylmethyl)cyclohexyl]acetamide (PubChem CID 125431329) has the molecular formula C16H24N8O and a molecular weight of 344.42 g/mol. Its IUPAC name is N-[2-(pyrimidin-2-ylamino)ethyl]-2-[1-(tetrazol-1-ylmethyl)cyclohexyl]acetamide.
| Compound Name | N-[2-(pyrimidin-2-ylamino)ethyl]-2-[1-(tetrazol-1-ylmethyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 125431329 |
| Molecular Formula | C16H24N8O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | N-[2-(pyrimidin-2-ylamino)ethyl]-2-[1-(tetrazol-1-ylmethyl)cyclohexyl]acetamide |
| SMILES | O=C(CC1(Cn2cnnn2)CCCCC1)NCCNc1ncccn1 |
| InChI | InChI=1S/C16H24N8O/c25-14(17-9-10-20-15-18-7-4-8-19-15)11-16(5-2-1-3-6-16)12-24-13-21-22-23-24/h4,7-8,13H,1-3,5-6,9-12H2,(H,17,25)(H,18,19,20) |
| InChIKey | XHCXNDSWOVBDCC-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|