C20H29N7O2 — CID 166335317
4-(propylamino)-3-[[2-[1-(tetrazol-1-ylmethyl)cyclohexyl]acetyl]amino]benzamide (PubChem CID 166335317) has the molecular formula C20H29N7O2 and a molecular weight of 399.50 g/mol. Its IUPAC name is 4-(propylamino)-3-[[2-[1-(tetrazol-1-ylmethyl)cyclohexyl]acetyl]amino]benzamide.
| Compound Name | 4-(propylamino)-3-[[2-[1-(tetrazol-1-ylmethyl)cyclohexyl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 166335317 |
| Molecular Formula | C20H29N7O2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | 4-(propylamino)-3-[[2-[1-(tetrazol-1-ylmethyl)cyclohexyl]acetyl]amino]benzamide |
| SMILES | CCCNc1ccc(C(N)=O)cc1NC(=O)CC1(Cn2cnnn2)CCCCC1 |
| InChI | InChI=1S/C20H29N7O2/c1-2-10-22-16-7-6-15(19(21)29)11-17(16)24-18(28)12-20(8-4-3-5-9-20)13-27-14-23-25-26-27/h6-7,11,14,22H,2-5,8-10,12-13H2,1H3,(H2,21,29)(H,24,28) |
| InChIKey | BGUPZMDUKYIAJS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |