C13H20N8O — CID 127254782
(2S,3S)-3-methyl-N-[2-(pyrimidin-2-ylamino)ethyl]-2-(tetrazol-1-yl)pentanamide (PubChem CID 127254782) has the molecular formula C13H20N8O and a molecular weight of 304.36 g/mol. Its IUPAC name is (2S,3S)-3-methyl-N-[2-(pyrimidin-2-ylamino)ethyl]-2-(tetrazol-1-yl)pentanamide.
| Compound Name | (2S,3S)-3-methyl-N-[2-(pyrimidin-2-ylamino)ethyl]-2-(tetrazol-1-yl)pentanamide |
|---|---|
| PubChem CID | 127254782 |
| Molecular Formula | C13H20N8O |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | (2S,3S)-3-methyl-N-[2-(pyrimidin-2-ylamino)ethyl]-2-(tetrazol-1-yl)pentanamide |
| SMILES | CC[C@H](C)[C@@H](C(=O)NCCNc1ncccn1)n1cnnn1 |
| InChI | InChI=1S/C13H20N8O/c1-3-10(2)11(21-9-18-19-20-21)12(22)14-7-8-17-13-15-5-4-6-16-13/h4-6,9-11H,3,7-8H2,1-2H3,(H,14,22)(H,15,16,17)/t10-,11-/m0/s1 |
| InChIKey | LEBVXRAAQURAQM-QWRGUYRKSA-N |
| XLogP | 0.28 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|