C17H29N5O2 — CID 94822505
(2S)-2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-methyl-N-[2-(pyrimidin-2-ylamino)ethyl]butanamide (PubChem CID 94822505) has the molecular formula C17H29N5O2 and a molecular weight of 335.45 g/mol. Its IUPAC name is (2S)-2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-methyl-N-[2-(pyrimidin-2-ylamino)ethyl]butanamide.
| Compound Name | (2S)-2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-methyl-N-[2-(pyrimidin-2-ylamino)ethyl]butanamide |
|---|---|
| PubChem CID | 94822505 |
| Molecular Formula | C17H29N5O2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | (2S)-2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-methyl-N-[2-(pyrimidin-2-ylamino)ethyl]butanamide |
| SMILES | CC(C)[C@@H](C(=O)NCCNc1ncccn1)N1C[C@@H](C)O[C@H](C)C1 |
| InChI | InChI=1S/C17H29N5O2/c1-12(2)15(22-10-13(3)24-14(4)11-22)16(23)18-8-9-21-17-19-6-5-7-20-17/h5-7,12-15H,8-11H2,1-4H3,(H,18,23)(H,19,20,21)/t13-,14-,15+/m1/s1 |
| InChIKey | AXXGCOOTEDLBCC-KFWWJZLASA-N |
| XLogP | 1.14 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|