C17H26N4O3 — CID 60592519
N'-[2-(2,6-dimethylmorpholin-4-yl)-3-methylbutanoyl]pyridine-3-carbohydrazide (PubChem CID 60592519) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is N'-[2-(2,6-dimethylmorpholin-4-yl)-3-methylbutanoyl]pyridine-3-carbohydrazide.
| Compound Name | N'-[2-(2,6-dimethylmorpholin-4-yl)-3-methylbutanoyl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 60592519 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | N'-[2-(2,6-dimethylmorpholin-4-yl)-3-methylbutanoyl]pyridine-3-carbohydrazide |
| SMILES | CC1CN(C(C(=O)NNC(=O)c2cccnc2)C(C)C)CC(C)O1 |
| InChI | InChI=1S/C17H26N4O3/c1-11(2)15(21-9-12(3)24-13(4)10-21)17(23)20-19-16(22)14-6-5-7-18-8-14/h5-8,11-13,15H,9-10H2,1-4H3,(H,19,22)(H,20,23) |
| InChIKey | CEXHAEDGRANVLN-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|