C17H25N3O2 — CID 98727647
(E)-N-[(2R)-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 98727647) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is (E)-N-[(2R)-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[(2R)-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 98727647 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (E)-N-[(2R)-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | C[C@@H]1CN([C@H](C)CNC(=O)/C=C/c2cccnc2)C[C@H](C)O1 |
| InChI | InChI=1S/C17H25N3O2/c1-13(20-11-14(2)22-15(3)12-20)9-19-17(21)7-6-16-5-4-8-18-10-16/h4-8,10,13-15H,9,11-12H2,1-3H3,(H,19,21)/b7-6+/t13-,14-,15+/m1/s1 |
| InChIKey | HJVNEHFZAGMTQD-AZDQDMGWSA-N |
| XLogP | 1.71 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|