C18H24Cl2N2O2 — CID 39650100
(E)-3-(2,4-dichlorophenyl)-N-[(2R)-2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]propyl]prop-2-enamide (PubChem CID 39650100) has the molecular formula C18H24Cl2N2O2 and a molecular weight of 371.31 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-[(2R)-2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]propyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-[(2R)-2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 39650100 |
| Molecular Formula | C18H24Cl2N2O2 |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-[(2R)-2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]propyl]prop-2-enamide |
| SMILES | C[C@@H]1CN([C@H](C)CNC(=O)/C=C/c2ccc(Cl)cc2Cl)C[C@@H](C)O1 |
| InChI | InChI=1S/C18H24Cl2N2O2/c1-12(22-10-13(2)24-14(3)11-22)9-21-18(23)7-5-15-4-6-16(19)8-17(15)20/h4-8,12-14H,9-11H2,1-3H3,(H,21,23)/b7-5+/t12-,13-,14-/m1/s1 |
| InChIKey | BHCQBEMURIRTJE-OVMWZURDSA-N |
| XLogP | 3.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|