C17H25N3O — CID 51090122
(E)-N-[2-(2-methylpiperidin-1-yl)propyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 51090122) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is (E)-N-[2-(2-methylpiperidin-1-yl)propyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[2-(2-methylpiperidin-1-yl)propyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 51090122 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | (E)-N-[2-(2-methylpiperidin-1-yl)propyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | CC1CCCCN1C(C)CNC(=O)/C=C/c1cccnc1 |
| InChI | InChI=1S/C17H25N3O/c1-14-6-3-4-11-20(14)15(2)12-19-17(21)9-8-16-7-5-10-18-13-16/h5,7-10,13-15H,3-4,6,11-12H2,1-2H3,(H,19,21)/b9-8+ |
| InChIKey | JUKKHINQDGDGRF-CMDGGOBGSA-N |
| XLogP | 2.47 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|