C19H27N3O2 — CID 10236764
(E)-N-[4-(1-acetylpiperidin-4-yl)butyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 10236764) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is (E)-N-[4-(1-acetylpiperidin-4-yl)butyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[4-(1-acetylpiperidin-4-yl)butyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 10236764 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | (E)-N-[4-(1-acetylpiperidin-4-yl)butyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | CC(=O)N1CCC(CCCCNC(=O)/C=C/c2cccnc2)CC1 |
| InChI | InChI=1S/C19H27N3O2/c1-16(23)22-13-9-17(10-14-22)5-2-3-12-21-19(24)8-7-18-6-4-11-20-15-18/h4,6-8,11,15,17H,2-3,5,9-10,12-14H2,1H3,(H,21,24)/b8-7+ |
| InChIKey | RIYGFDAGQVEUIR-BQYQJAHWSA-N |
| XLogP | 2.64 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|