C30H35N3O2 — CID 15616538
(E)-N-[4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 15616538) has the molecular formula C30H35N3O2 and a molecular weight of 469.63 g/mol. Its IUPAC name is (E)-N-[4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 15616538 |
| Molecular Formula | C30H35N3O2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | (E)-N-[4-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]butyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccnc1)NCCCCN1CCC(C(O)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C30H35N3O2/c34-29(16-15-25-10-9-19-31-24-25)32-20-7-8-21-33-22-17-28(18-23-33)30(35,26-11-3-1-4-12-26)27-13-5-2-6-14-27/h1-6,9-16,19,24,28,35H,7-8,17-18,20-23H2,(H,32,34)/b16-15+ |
| InChIKey | ZVPYJIZZZFVPSG-FOCLMDBBSA-N |
| XLogP | 4.64 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|