C25H30N4O — CID 66595400
(Z)-N-[4-[4-(1H-indol-3-yl)piperidin-1-yl]butyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 66595400) has the molecular formula C25H30N4O and a molecular weight of 402.54 g/mol. Its IUPAC name is (Z)-N-[4-[4-(1H-indol-3-yl)piperidin-1-yl]butyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (Z)-N-[4-[4-(1H-indol-3-yl)piperidin-1-yl]butyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 66595400 |
| Molecular Formula | C25H30N4O |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | (Z)-N-[4-[4-(1H-indol-3-yl)piperidin-1-yl]butyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | O=C(/C=C\c1cccnc1)NCCCCN1CCC(c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C25H30N4O/c30-25(10-9-20-6-5-13-26-18-20)27-14-3-4-15-29-16-11-21(12-17-29)23-19-28-24-8-2-1-7-22(23)24/h1-2,5-10,13,18-19,21,28H,3-4,11-12,14-17H2,(H,27,30)/b10-9- |
| InChIKey | NGBNRCCMTHHKSH-KTKRTIGZSA-N |
| XLogP | 4.35 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|