C34H45N3O2 — CID 10530187
(2E,4E)-5-(3,5-ditert-butyl-4-hydroxyphenyl)-N-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide (PubChem CID 10530187) has the molecular formula C34H45N3O2 and a molecular weight of 527.75 g/mol. Its IUPAC name is (2E,4E)-5-(3,5-ditert-butyl-4-hydroxyphenyl)-N-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide.
| Compound Name | (2E,4E)-5-(3,5-ditert-butyl-4-hydroxyphenyl)-N-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 10530187 |
| Molecular Formula | C34H45N3O2 |
| Molecular Weight | 527.75 g/mol |
| Exact Mass | 527.35 |
| IUPAC Name | (2E,4E)-5-(3,5-ditert-butyl-4-hydroxyphenyl)-N-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide |
| SMILES | CC(C)(C)c1cc(/C=C/C=C/C(=O)NCCN2CCC(c3c[nH]c4ccccc34)CC2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C34H45N3O2/c1-33(2,3)28-21-24(22-29(32(28)39)34(4,5)6)11-7-10-14-31(38)35-17-20-37-18-15-25(16-19-37)27-23-36-30-13-9-8-12-26(27)30/h7-14,21-23,25,36,39H,15-20H2,1-6H3,(H,35,38)/b11-7+,14-10+ |
| InChIKey | FVACAXIERVZNMB-MYUCQOFCSA-N |
| XLogP | 7.03 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.75 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|