C30H35Cl2N3O — CID 44534006
(E)-3-(3,4-dichlorophenyl)-N-[2-[4-[4-(1H-indol-3-yl)piperidin-1-yl]cyclohexyl]ethyl]prop-2-enamide (PubChem CID 44534006) has the molecular formula C30H35Cl2N3O and a molecular weight of 524.54 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[2-[4-[4-(1H-indol-3-yl)piperidin-1-yl]cyclohexyl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[2-[4-[4-(1H-indol-3-yl)piperidin-1-yl]cyclohexyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 44534006 |
| Molecular Formula | C30H35Cl2N3O |
| Molecular Weight | 524.54 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[2-[4-[4-(1H-indol-3-yl)piperidin-1-yl]cyclohexyl]ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCCC1CCC(N2CCC(c3c[nH]c4ccccc34)CC2)CC1 |
| InChI | InChI=1S/C30H35Cl2N3O/c31-27-11-7-22(19-28(27)32)8-12-30(36)33-16-13-21-5-9-24(10-6-21)35-17-14-23(15-18-35)26-20-34-29-4-2-1-3-25(26)29/h1-4,7-8,11-12,19-21,23-24,34H,5-6,9-10,13-18H2,(H,33,36)/b12-8+ |
| InChIKey | ZZEORAWDZHRABV-XYOKQWHBSA-N |
| XLogP | 7.43 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.54 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|