C20H18Cl2N2O — CID 84558891
(3,4-dichlorophenyl)-[4-(1H-indol-3-yl)piperidin-1-yl]methanone (PubChem CID 84558891) has the molecular formula C20H18Cl2N2O and a molecular weight of 373.28 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-[4-(1H-indol-3-yl)piperidin-1-yl]methanone.
| Compound Name | (3,4-dichlorophenyl)-[4-(1H-indol-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 84558891 |
| Molecular Formula | C20H18Cl2N2O |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | (3,4-dichlorophenyl)-[4-(1H-indol-3-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)N1CCC(c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C20H18Cl2N2O/c21-17-6-5-14(11-18(17)22)20(25)24-9-7-13(8-10-24)16-12-23-19-4-2-1-3-15(16)19/h1-6,11-13,23H,7-10H2 |
| InChIKey | LLUQOHZAXPBESH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |