C28H40N4O — CID 68564319
(4-cyclopentylpiperazin-1-yl)-[3-(1-cyclopentylpiperidin-4-yl)-1H-indol-6-yl]methanone (PubChem CID 68564319) has the molecular formula C28H40N4O and a molecular weight of 448.66 g/mol. Its IUPAC name is (4-cyclopentylpiperazin-1-yl)-[3-(1-cyclopentylpiperidin-4-yl)-1H-indol-6-yl]methanone.
| Compound Name | (4-cyclopentylpiperazin-1-yl)-[3-(1-cyclopentylpiperidin-4-yl)-1H-indol-6-yl]methanone |
|---|---|
| PubChem CID | 68564319 |
| Molecular Formula | C28H40N4O |
| Molecular Weight | 448.66 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | (4-cyclopentylpiperazin-1-yl)-[3-(1-cyclopentylpiperidin-4-yl)-1H-indol-6-yl]methanone |
| SMILES | O=C(c1ccc2c(C3CCN(C4CCCC4)CC3)c[nH]c2c1)N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C28H40N4O/c33-28(32-17-15-31(16-18-32)24-7-3-4-8-24)22-9-10-25-26(20-29-27(25)19-22)21-11-13-30(14-12-21)23-5-1-2-6-23/h9-10,19-21,23-24,29H,1-8,11-18H2 |
| InChIKey | XBRFPEPTGYSMJR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 42.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.66 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |