C24H36N4O — CID 68563854
(4-propan-2-ylpiperazin-1-yl)-[3-(1-propan-2-ylpiperidin-3-yl)-1H-indol-6-yl]methanone (PubChem CID 68563854) has the molecular formula C24H36N4O and a molecular weight of 396.58 g/mol. Its IUPAC name is (4-propan-2-ylpiperazin-1-yl)-[3-(1-propan-2-ylpiperidin-3-yl)-1H-indol-6-yl]methanone.
| Compound Name | (4-propan-2-ylpiperazin-1-yl)-[3-(1-propan-2-ylpiperidin-3-yl)-1H-indol-6-yl]methanone |
|---|---|
| PubChem CID | 68563854 |
| Molecular Formula | C24H36N4O |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | (4-propan-2-ylpiperazin-1-yl)-[3-(1-propan-2-ylpiperidin-3-yl)-1H-indol-6-yl]methanone |
| SMILES | CC(C)N1CCN(C(=O)c2ccc3c(C4CCCN(C(C)C)C4)c[nH]c3c2)CC1 |
| InChI | InChI=1S/C24H36N4O/c1-17(2)26-10-12-27(13-11-26)24(29)19-7-8-21-22(15-25-23(21)14-19)20-6-5-9-28(16-20)18(3)4/h7-8,14-15,17-18,20,25H,5-6,9-13,16H2,1-4H3 |
| InChIKey | CMDOCHYHGAMGNT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 42.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |