C29H38N4O — CID 25059867
[3-[(4-benzylpiperidin-1-yl)methyl]-1H-indol-6-yl]-(4-propan-2-ylpiperazin-1-yl)methanone (PubChem CID 25059867) has the molecular formula C29H38N4O and a molecular weight of 458.65 g/mol. Its IUPAC name is [3-[(4-benzylpiperidin-1-yl)methyl]-1H-indol-6-yl]-(4-propan-2-ylpiperazin-1-yl)methanone.
| Compound Name | [3-[(4-benzylpiperidin-1-yl)methyl]-1H-indol-6-yl]-(4-propan-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 25059867 |
| Molecular Formula | C29H38N4O |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | [3-[(4-benzylpiperidin-1-yl)methyl]-1H-indol-6-yl]-(4-propan-2-ylpiperazin-1-yl)methanone |
| SMILES | CC(C)N1CCN(C(=O)c2ccc3c(CN4CCC(Cc5ccccc5)CC4)c[nH]c3c2)CC1 |
| InChI | InChI=1S/C29H38N4O/c1-22(2)32-14-16-33(17-15-32)29(34)25-8-9-27-26(20-30-28(27)19-25)21-31-12-10-24(11-13-31)18-23-6-4-3-5-7-23/h3-9,19-20,22,24,30H,10-18,21H2,1-2H3 |
| InChIKey | XMJBHRLUPBNGJU-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 42.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |