C24H24N2O3 — CID 138530082
1-[5-(4-benzylpiperidine-1-carbonyl)-1H-indol-3-yl]propane-1,2-dione (PubChem CID 138530082) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is 1-[5-(4-benzylpiperidine-1-carbonyl)-1H-indol-3-yl]propane-1,2-dione.
| Compound Name | 1-[5-(4-benzylpiperidine-1-carbonyl)-1H-indol-3-yl]propane-1,2-dione |
|---|---|
| PubChem CID | 138530082 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 1-[5-(4-benzylpiperidine-1-carbonyl)-1H-indol-3-yl]propane-1,2-dione |
| SMILES | CC(=O)C(=O)c1c[nH]c2ccc(C(=O)N3CCC(Cc4ccccc4)CC3)cc12 |
| InChI | InChI=1S/C24H24N2O3/c1-16(27)23(28)21-15-25-22-8-7-19(14-20(21)22)24(29)26-11-9-18(10-12-26)13-17-5-3-2-4-6-17/h2-8,14-15,18,25H,9-13H2,1H3 |
| InChIKey | MRQLSRUIYWPNPO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|