C24H24N2O4 — CID 20626155
2-[5-(4-benzylpiperidine-1-carbonyl)-6-methyl-1H-indol-3-yl]-2-oxoacetic acid (PubChem CID 20626155) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is 2-[5-(4-benzylpiperidine-1-carbonyl)-6-methyl-1H-indol-3-yl]-2-oxoacetic acid.
| Compound Name | 2-[5-(4-benzylpiperidine-1-carbonyl)-6-methyl-1H-indol-3-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 20626155 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 2-[5-(4-benzylpiperidine-1-carbonyl)-6-methyl-1H-indol-3-yl]-2-oxoacetic acid |
| SMILES | Cc1cc2[nH]cc(C(=O)C(=O)O)c2cc1C(=O)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H24N2O4/c1-15-11-21-19(20(14-25-21)22(27)24(29)30)13-18(15)23(28)26-9-7-17(8-10-26)12-16-5-3-2-4-6-16/h2-6,11,13-14,17,25H,7-10,12H2,1H3,(H,29,30) |
| InChIKey | FJCQJKDSQOVNEI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|