C28H32N3O4P — CID 142871702
1-[6-methoxy-5-[4-[(4-phosphanylphenyl)methyl]piperidine-1-carbonyl]-1H-indol-3-yl]-2-pyrrolidin-1-ylethane-1,2-dione (PubChem CID 142871702) has the molecular formula C28H32N3O4P and a molecular weight of 505.56 g/mol. Its IUPAC name is 1-[6-methoxy-5-[4-[(4-phosphanylphenyl)methyl]piperidine-1-carbonyl]-1H-indol-3-yl]-2-pyrrolidin-1-ylethane-1,2-dione.
| Compound Name | 1-[6-methoxy-5-[4-[(4-phosphanylphenyl)methyl]piperidine-1-carbonyl]-1H-indol-3-yl]-2-pyrrolidin-1-ylethane-1,2-dione |
|---|---|
| PubChem CID | 142871702 |
| Molecular Formula | C28H32N3O4P |
| Molecular Weight | 505.56 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | 1-[6-methoxy-5-[4-[(4-phosphanylphenyl)methyl]piperidine-1-carbonyl]-1H-indol-3-yl]-2-pyrrolidin-1-ylethane-1,2-dione |
| SMILES | COc1cc2[nH]cc(C(=O)C(=O)N3CCCC3)c2cc1C(=O)N1CCC(Cc2ccc(P)cc2)CC1 |
| InChI | InChI=1S/C28H32N3O4P/c1-35-25-16-24-21(23(17-29-24)26(32)28(34)30-10-2-3-11-30)15-22(25)27(33)31-12-8-19(9-13-31)14-18-4-6-20(36)7-5-18/h4-7,15-17,19,29H,2-3,8-14,36H2,1H3 |
| InChIKey | ZMNWEICNATURAO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|