C23H24N2O3 — CID 56925383
1-(4-benzylpiperidin-1-yl)-2-(7-methoxy-1H-indol-3-yl)ethane-1,2-dione (PubChem CID 56925383) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-(4-benzylpiperidin-1-yl)-2-(7-methoxy-1H-indol-3-yl)ethane-1,2-dione.
| Compound Name | 1-(4-benzylpiperidin-1-yl)-2-(7-methoxy-1H-indol-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 56925383 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 1-(4-benzylpiperidin-1-yl)-2-(7-methoxy-1H-indol-3-yl)ethane-1,2-dione |
| SMILES | COc1cccc2c(C(=O)C(=O)N3CCC(Cc4ccccc4)CC3)c[nH]c12 |
| InChI | InChI=1S/C23H24N2O3/c1-28-20-9-5-8-18-19(15-24-21(18)20)22(26)23(27)25-12-10-17(11-13-25)14-16-6-3-2-4-7-16/h2-9,15,17,24H,10-14H2,1H3 |
| InChIKey | BTHKOHXXHHCGBH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|