C27H34N4O — CID 141125371
(4-benzylpiperidin-1-yl)-[3-(2-piperazin-1-ylethyl)-1H-indol-5-yl]methanone (PubChem CID 141125371) has the molecular formula C27H34N4O and a molecular weight of 430.60 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-[3-(2-piperazin-1-ylethyl)-1H-indol-5-yl]methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-[3-(2-piperazin-1-ylethyl)-1H-indol-5-yl]methanone |
|---|---|
| PubChem CID | 141125371 |
| Molecular Formula | C27H34N4O |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-[3-(2-piperazin-1-ylethyl)-1H-indol-5-yl]methanone |
| SMILES | O=C(c1ccc2[nH]cc(CCN3CCNCC3)c2c1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H34N4O/c32-27(31-14-8-22(9-15-31)18-21-4-2-1-3-5-21)23-6-7-26-25(19-23)24(20-29-26)10-13-30-16-11-28-12-17-30/h1-7,19-20,22,28-29H,8-18H2 |
| InChIKey | OKHFURJFKCSBCI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |