C24H24N4OS — CID 55823602
[4-(1H-indol-3-yl)piperidin-1-yl]-[3-(2-methylsulfanylimidazol-1-yl)phenyl]methanone (PubChem CID 55823602) has the molecular formula C24H24N4OS and a molecular weight of 416.55 g/mol. Its IUPAC name is [4-(1H-indol-3-yl)piperidin-1-yl]-[3-(2-methylsulfanylimidazol-1-yl)phenyl]methanone.
| Compound Name | [4-(1H-indol-3-yl)piperidin-1-yl]-[3-(2-methylsulfanylimidazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 55823602 |
| Molecular Formula | C24H24N4OS |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | [4-(1H-indol-3-yl)piperidin-1-yl]-[3-(2-methylsulfanylimidazol-1-yl)phenyl]methanone |
| SMILES | CSc1nccn1-c1cccc(C(=O)N2CCC(c3c[nH]c4ccccc34)CC2)c1 |
| InChI | InChI=1S/C24H24N4OS/c1-30-24-25-11-14-28(24)19-6-4-5-18(15-19)23(29)27-12-9-17(10-13-27)21-16-26-22-8-3-2-7-20(21)22/h2-8,11,14-17,26H,9-10,12-13H2,1H3 |
| InChIKey | AGFBYTGMWYNJMC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |