C27H29Cl2N3O — CID 70166096
3-(3,4-dichlorophenyl)-1-[4-[4-(1H-indol-3-yl)piperidin-1-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 70166096) has the molecular formula C27H29Cl2N3O and a molecular weight of 482.46 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-[4-[4-(1H-indol-3-yl)piperidin-1-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(3,4-dichlorophenyl)-1-[4-[4-(1H-indol-3-yl)piperidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 70166096 |
| Molecular Formula | C27H29Cl2N3O |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-[4-[4-(1H-indol-3-yl)piperidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(Cl)c(Cl)c1)N1CCC(N2CCC(c3c[nH]c4ccccc34)CC2)CC1 |
| InChI | InChI=1S/C27H29Cl2N3O/c28-24-7-5-19(17-25(24)29)6-8-27(33)32-15-11-21(12-16-32)31-13-9-20(10-14-31)23-18-30-26-4-2-1-3-22(23)26/h1-8,17-18,20-21,30H,9-16H2 |
| InChIKey | OGGOXQIGJLAJRP-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|