C29H33Cl2N3O — CID 44534340
(E)-3-(3,4-dichlorophenyl)-1-[4-[[4-(1H-indol-3-ylmethyl)piperidin-1-yl]methyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 44534340) has the molecular formula C29H33Cl2N3O and a molecular weight of 510.51 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-1-[4-[[4-(1H-indol-3-ylmethyl)piperidin-1-yl]methyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-1-[4-[[4-(1H-indol-3-ylmethyl)piperidin-1-yl]methyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 44534340 |
| Molecular Formula | C29H33Cl2N3O |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-1-[4-[[4-(1H-indol-3-ylmethyl)piperidin-1-yl]methyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)N1CCC(CN2CCC(Cc3c[nH]c4ccccc34)CC2)CC1 |
| InChI | InChI=1S/C29H33Cl2N3O/c30-26-7-5-21(18-27(26)31)6-8-29(35)34-15-11-23(12-16-34)20-33-13-9-22(10-14-33)17-24-19-32-28-4-2-1-3-25(24)28/h1-8,18-19,22-23,32H,9-17,20H2/b8-6+ |
| InChIKey | WBJPTIARYMDWOQ-SOFGYWHQSA-N |
| XLogP | 6.68 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|