C35H39N3O — CID 45481005
(E)-1-[4-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]piperidin-1-yl]-3-(4-phenylphenyl)prop-2-en-1-one (PubChem CID 45481005) has the molecular formula C35H39N3O and a molecular weight of 517.72 g/mol. Its IUPAC name is (E)-1-[4-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]piperidin-1-yl]-3-(4-phenylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]piperidin-1-yl]-3-(4-phenylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 45481005 |
| Molecular Formula | C35H39N3O |
| Molecular Weight | 517.72 g/mol |
| Exact Mass | 517.31 |
| IUPAC Name | (E)-1-[4-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]piperidin-1-yl]-3-(4-phenylphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(-c2ccccc2)cc1)N1CCC(CCN2CCC(c3c[nH]c4ccccc34)CC2)CC1 |
| InChI | InChI=1S/C35H39N3O/c39-35(15-12-27-10-13-30(14-11-27)29-6-2-1-3-7-29)38-24-17-28(18-25-38)16-21-37-22-19-31(20-23-37)33-26-36-34-9-5-4-8-32(33)34/h1-15,26,28,31,36H,16-25H2/b15-12+ |
| InChIKey | MOIKFOFBLRHJTR-NTCAYCPXSA-N |
| XLogP | 7.36 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.72 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|