C29H35N3O — CID 44533348
(2E,4E)-N-[5-[4-(1H-indol-3-yl)piperidin-1-yl]pentyl]-5-phenylpenta-2,4-dienamide (PubChem CID 44533348) has the molecular formula C29H35N3O and a molecular weight of 441.62 g/mol. Its IUPAC name is (2E,4E)-N-[5-[4-(1H-indol-3-yl)piperidin-1-yl]pentyl]-5-phenylpenta-2,4-dienamide.
| Compound Name | (2E,4E)-N-[5-[4-(1H-indol-3-yl)piperidin-1-yl]pentyl]-5-phenylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 44533348 |
| Molecular Formula | C29H35N3O |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.28 |
| IUPAC Name | (2E,4E)-N-[5-[4-(1H-indol-3-yl)piperidin-1-yl]pentyl]-5-phenylpenta-2,4-dienamide |
| SMILES | O=C(/C=C/C=C/c1ccccc1)NCCCCCN1CCC(c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C29H35N3O/c33-29(16-8-5-13-24-11-3-1-4-12-24)30-19-9-2-10-20-32-21-17-25(18-22-32)27-23-31-28-15-7-6-14-26(27)28/h1,3-8,11-16,23,25,31H,2,9-10,17-22H2,(H,30,33)/b13-5+,16-8+ |
| InChIKey | CGKHVQOMCXGFMS-VMUIEEQSSA-N |
| XLogP | 5.90 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|