C26H27Cl2N3O2 — CID 54305331
5-(3,5-dichloro-4-hydroxyphenyl)-N-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide (PubChem CID 54305331) has the molecular formula C26H27Cl2N3O2 and a molecular weight of 484.43 g/mol. Its IUPAC name is 5-(3,5-dichloro-4-hydroxyphenyl)-N-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide.
| Compound Name | 5-(3,5-dichloro-4-hydroxyphenyl)-N-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 54305331 |
| Molecular Formula | C26H27Cl2N3O2 |
| Molecular Weight | 484.43 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 5-(3,5-dichloro-4-hydroxyphenyl)-N-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]penta-2,4-dienamide |
| SMILES | O=C(C=CC=Cc1cc(Cl)c(O)c(Cl)c1)NCCN1CCC(c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C26H27Cl2N3O2/c27-22-15-18(16-23(28)26(22)33)5-1-4-8-25(32)29-11-14-31-12-9-19(10-13-31)21-17-30-24-7-3-2-6-20(21)24/h1-8,15-17,19,30,33H,9-14H2,(H,29,32) |
| InChIKey | SHCAYSHXUORXNO-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.43 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|