C30H37N3O4 — CID 23046179
(2E,4E)-5-(4-hydroxy-3,5-dimethoxyphenyl)-N-[4-[4-(1H-indol-3-yl)piperidin-1-yl]butyl]penta-2,4-dienamide (PubChem CID 23046179) has the molecular formula C30H37N3O4 and a molecular weight of 503.64 g/mol. Its IUPAC name is (2E,4E)-5-(4-hydroxy-3,5-dimethoxyphenyl)-N-[4-[4-(1H-indol-3-yl)piperidin-1-yl]butyl]penta-2,4-dienamide.
| Compound Name | (2E,4E)-5-(4-hydroxy-3,5-dimethoxyphenyl)-N-[4-[4-(1H-indol-3-yl)piperidin-1-yl]butyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 23046179 |
| Molecular Formula | C30H37N3O4 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | (2E,4E)-5-(4-hydroxy-3,5-dimethoxyphenyl)-N-[4-[4-(1H-indol-3-yl)piperidin-1-yl]butyl]penta-2,4-dienamide |
| SMILES | COc1cc(/C=C/C=C/C(=O)NCCCCN2CCC(c3c[nH]c4ccccc34)CC2)cc(OC)c1O |
| InChI | InChI=1S/C30H37N3O4/c1-36-27-19-22(20-28(37-2)30(27)35)9-3-6-12-29(34)31-15-7-8-16-33-17-13-23(14-18-33)25-21-32-26-11-5-4-10-24(25)26/h3-6,9-12,19-21,23,32,35H,7-8,13-18H2,1-2H3,(H,31,34)/b9-3+,12-6+ |
| InChIKey | QNZXAHIHUWGUCW-XCCLWPCOSA-N |
| XLogP | 5.24 |
| TPSA | 86.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|