C32H37N3O7 — CID 54518715
[2-ethoxycarbonyloxy-4-[5-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethylamino]-5-oxopenta-1,3-dienyl]phenyl] ethyl carbonate (PubChem CID 54518715) has the molecular formula C32H37N3O7 and a molecular weight of 575.66 g/mol. Its IUPAC name is [2-ethoxycarbonyloxy-4-[5-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethylamino]-5-oxopenta-1,3-dienyl]phenyl] ethyl carbonate.
| Compound Name | [2-ethoxycarbonyloxy-4-[5-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethylamino]-5-oxopenta-1,3-dienyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 54518715 |
| Molecular Formula | C32H37N3O7 |
| Molecular Weight | 575.66 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | [2-ethoxycarbonyloxy-4-[5-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethylamino]-5-oxopenta-1,3-dienyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C=CC=CC(=O)NCCN2CCC(c3c[nH]c4ccccc34)CC2)cc1OC(=O)OCC |
| InChI | InChI=1S/C32H37N3O7/c1-3-39-31(37)41-28-14-13-23(21-29(28)42-32(38)40-4-2)9-5-8-12-30(36)33-17-20-35-18-15-24(16-19-35)26-22-34-27-11-7-6-10-25(26)27/h5-14,21-22,24,34H,3-4,15-20H2,1-2H3,(H,33,36) |
| InChIKey | YOFZCLRRRXBCME-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 119.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.66 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|