C22H25N3O — CID 54526531
N-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]benzamide (PubChem CID 54526531) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is N-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]benzamide.
| Compound Name | N-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 54526531 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | N-[2-[4-(1H-indol-3-yl)piperidin-1-yl]ethyl]benzamide |
| SMILES | O=C(NCCN1CCC(c2c[nH]c3ccccc23)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H25N3O/c26-22(18-6-2-1-3-7-18)23-12-15-25-13-10-17(11-14-25)20-16-24-21-9-5-4-8-19(20)21/h1-9,16-17,24H,10-15H2,(H,23,26) |
| InChIKey | YTMMYHUPESJHJA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |