C24H28N4O — CID 13056042
3-[4-[4-(1H-indol-3-yl)piperidin-1-yl]butyl]-1H-benzimidazol-2-one (PubChem CID 13056042) has the molecular formula C24H28N4O and a molecular weight of 388.51 g/mol. Its IUPAC name is 3-[4-[4-(1H-indol-3-yl)piperidin-1-yl]butyl]-1H-benzimidazol-2-one.
| Compound Name | 3-[4-[4-(1H-indol-3-yl)piperidin-1-yl]butyl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 13056042 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 3-[4-[4-(1H-indol-3-yl)piperidin-1-yl]butyl]-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2ccccc2n1CCCCN1CCC(c2c[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C24H28N4O/c29-24-26-22-9-3-4-10-23(22)28(24)14-6-5-13-27-15-11-18(12-16-27)20-17-25-21-8-2-1-7-19(20)21/h1-4,7-10,17-18,25H,5-6,11-16H2,(H,26,29) |
| InChIKey | LATQGRTVVMFSAM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 56.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|