C24H28N2O3 — CID 23444870
2-[3-[3-[4-(1H-indol-3-yl)piperidin-1-yl]propoxy]phenyl]acetic acid (PubChem CID 23444870) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-[3-[3-[4-(1H-indol-3-yl)piperidin-1-yl]propoxy]phenyl]acetic acid.
| Compound Name | 2-[3-[3-[4-(1H-indol-3-yl)piperidin-1-yl]propoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 23444870 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 2-[3-[3-[4-(1H-indol-3-yl)piperidin-1-yl]propoxy]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(OCCCN2CCC(c3c[nH]c4ccccc34)CC2)c1 |
| InChI | InChI=1S/C24H28N2O3/c27-24(28)16-18-5-3-6-20(15-18)29-14-4-11-26-12-9-19(10-13-26)22-17-25-23-8-2-1-7-21(22)23/h1-3,5-8,15,17,19,25H,4,9-14,16H2,(H,27,28) |
| InChIKey | JIDPRKZOSRHXNH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|