C28H36N2O3 — CID 90750951
2-[3-[2-[4-[1-(3-methylbutan-2-yl)indol-3-yl]piperidin-1-yl]ethoxy]phenyl]acetic acid (PubChem CID 90750951) has the molecular formula C28H36N2O3 and a molecular weight of 448.61 g/mol. Its IUPAC name is 2-[3-[2-[4-[1-(3-methylbutan-2-yl)indol-3-yl]piperidin-1-yl]ethoxy]phenyl]acetic acid.
| Compound Name | 2-[3-[2-[4-[1-(3-methylbutan-2-yl)indol-3-yl]piperidin-1-yl]ethoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 90750951 |
| Molecular Formula | C28H36N2O3 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | 2-[3-[2-[4-[1-(3-methylbutan-2-yl)indol-3-yl]piperidin-1-yl]ethoxy]phenyl]acetic acid |
| SMILES | CC(C)C(C)n1cc(C2CCN(CCOc3cccc(CC(=O)O)c3)CC2)c2ccccc21 |
| InChI | InChI=1S/C28H36N2O3/c1-20(2)21(3)30-19-26(25-9-4-5-10-27(25)30)23-11-13-29(14-12-23)15-16-33-24-8-6-7-22(17-24)18-28(31)32/h4-10,17,19-21,23H,11-16,18H2,1-3H3,(H,31,32) |
| InChIKey | UKGFMIZJEIIOFC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |