C28H36N2O4 — CID 23444838
2-[4-[3-[4-[1-(2-ethoxyethyl)indol-3-yl]piperidin-1-yl]propoxy]phenyl]acetic acid (PubChem CID 23444838) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is 2-[4-[3-[4-[1-(2-ethoxyethyl)indol-3-yl]piperidin-1-yl]propoxy]phenyl]acetic acid.
| Compound Name | 2-[4-[3-[4-[1-(2-ethoxyethyl)indol-3-yl]piperidin-1-yl]propoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 23444838 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | 2-[4-[3-[4-[1-(2-ethoxyethyl)indol-3-yl]piperidin-1-yl]propoxy]phenyl]acetic acid |
| SMILES | CCOCCn1cc(C2CCN(CCCOc3ccc(CC(=O)O)cc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C28H36N2O4/c1-2-33-19-17-30-21-26(25-6-3-4-7-27(25)30)23-12-15-29(16-13-23)14-5-18-34-24-10-8-22(9-11-24)20-28(31)32/h3-4,6-11,21,23H,2,5,12-20H2,1H3,(H,31,32) |
| InChIKey | XHKCJTILCZBBNJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|