C56H72N4O7 — CID 158898592
2-[3-[2-[4-[1-(2-ethoxyethyl)indol-3-yl]piperidin-1-yl]ethoxy]phenyl]acetic acid;2-[3-[3-[4-[1-(3-methylbutyl)indol-3-yl]piperidin-1-yl]propoxy]phenyl]acetic acid (PubChem CID 158898592) has the molecular formula C56H72N4O7 and a molecular weight of 913.21 g/mol. Its IUPAC name is 2-[3-[2-[4-[1-(2-ethoxyethyl)indol-3-yl]piperidin-1-yl]ethoxy]phenyl]acetic acid;2-[3-[3-[4-[1-(3-methylbutyl)indol-3-yl]piperidin-1-yl]propoxy]phenyl]acetic acid.
| Compound Name | 2-[3-[2-[4-[1-(2-ethoxyethyl)indol-3-yl]piperidin-1-yl]ethoxy]phenyl]acetic acid;2-[3-[3-[4-[1-(3-methylbutyl)indol-3-yl]piperidin-1-yl]propoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 158898592 |
| Molecular Formula | C56H72N4O7 |
| Molecular Weight | 913.21 g/mol |
| Exact Mass | 912.54 |
| IUPAC Name | 2-[3-[2-[4-[1-(2-ethoxyethyl)indol-3-yl]piperidin-1-yl]ethoxy]phenyl]acetic acid;2-[3-[3-[4-[1-(3-methylbutyl)indol-3-yl]piperidin-1-yl]propoxy]phenyl]acetic acid |
| SMILES | CC(C)CCn1cc(C2CCN(CCCOc3cccc(CC(=O)O)c3)CC2)c2ccccc21.CCOCCn1cc(C2CCN(CCOc3cccc(CC(=O)O)c3)CC2)c2ccccc21 |
| InChI | InChI=1S/C29H38N2O3.C27H34N2O4/c1-22(2)11-17-31-21-27(26-9-3-4-10-28(26)31)24-12-15-30(16-13-24)14-6-18-34-25-8-5-7-23(19-25)20-29(32)33;1-2-32-16-15-29-20-25(24-8-3-4-9-26(24)29)22-10-12-28(13-11-22)14-17-33-23-7-5-6-21(18-23)19-27(30)31/h3-5,7-10,19,21-22,24H,6,11-18,20H2,1-2H3,(H,32,33);3-9,18,20,22H,2,10-17,19H2,1H3,(H,30,31) |
| InChIKey | JFDIUTREQASFJW-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 118.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.21 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|