C28H29N3O3 — CID 10115186
2-[2-[4-[1-(pyridin-4-ylmethyl)indol-3-yl]piperidin-1-yl]ethoxy]benzoic acid (PubChem CID 10115186) has the molecular formula C28H29N3O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is 2-[2-[4-[1-(pyridin-4-ylmethyl)indol-3-yl]piperidin-1-yl]ethoxy]benzoic acid.
| Compound Name | 2-[2-[4-[1-(pyridin-4-ylmethyl)indol-3-yl]piperidin-1-yl]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 10115186 |
| Molecular Formula | C28H29N3O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 2-[2-[4-[1-(pyridin-4-ylmethyl)indol-3-yl]piperidin-1-yl]ethoxy]benzoic acid |
| SMILES | O=C(O)c1ccccc1OCCN1CCC(c2cn(Cc3ccncc3)c3ccccc23)CC1 |
| InChI | InChI=1S/C28H29N3O3/c32-28(33)24-6-2-4-8-27(24)34-18-17-30-15-11-22(12-16-30)25-20-31(19-21-9-13-29-14-10-21)26-7-3-1-5-23(25)26/h1-10,13-14,20,22H,11-12,15-19H2,(H,32,33) |
| InChIKey | FHWWSGZJWMFRBI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |