C30H30N2O6 — CID 174438853
2-[carboxy-[4-[1-[(4-methoxyphenyl)methyl]indol-3-yl]piperidin-1-yl]methoxy]benzoic acid (PubChem CID 174438853) has the molecular formula C30H30N2O6 and a molecular weight of 514.58 g/mol. Its IUPAC name is 2-[carboxy-[4-[1-[(4-methoxyphenyl)methyl]indol-3-yl]piperidin-1-yl]methoxy]benzoic acid.
| Compound Name | 2-[carboxy-[4-[1-[(4-methoxyphenyl)methyl]indol-3-yl]piperidin-1-yl]methoxy]benzoic acid |
|---|---|
| PubChem CID | 174438853 |
| Molecular Formula | C30H30N2O6 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 2-[carboxy-[4-[1-[(4-methoxyphenyl)methyl]indol-3-yl]piperidin-1-yl]methoxy]benzoic acid |
| SMILES | COc1ccc(Cn2cc(C3CCN(C(Oc4ccccc4C(=O)O)C(=O)O)CC3)c3ccccc32)cc1 |
| InChI | InChI=1S/C30H30N2O6/c1-37-22-12-10-20(11-13-22)18-32-19-25(23-6-2-4-8-26(23)32)21-14-16-31(17-15-21)28(30(35)36)38-27-9-5-3-7-24(27)29(33)34/h2-13,19,21,28H,14-18H2,1H3,(H,33,34)(H,35,36) |
| InChIKey | QTUDIBAEBOIJCV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |