C42H41NO5 — CID 71485419
1-[(4-methoxyphenyl)methyl]-3-[(2S,3S,4S,5R)-3,4,5-tris(phenylmethoxy)oxan-2-yl]indole (PubChem CID 71485419) has the molecular formula C42H41NO5 and a molecular weight of 639.79 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-3-[(2S,3S,4S,5R)-3,4,5-tris(phenylmethoxy)oxan-2-yl]indole.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-3-[(2S,3S,4S,5R)-3,4,5-tris(phenylmethoxy)oxan-2-yl]indole |
|---|---|
| PubChem CID | 71485419 |
| Molecular Formula | C42H41NO5 |
| Molecular Weight | 639.79 g/mol |
| Exact Mass | 639.30 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-3-[(2S,3S,4S,5R)-3,4,5-tris(phenylmethoxy)oxan-2-yl]indole |
| SMILES | COc1ccc(Cn2cc([C@@H]3OC[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C42H41NO5/c1-44-35-23-21-31(22-24-35)25-43-26-37(36-19-11-12-20-38(36)43)40-42(47-29-34-17-9-4-10-18-34)41(46-28-33-15-7-3-8-16-33)39(30-48-40)45-27-32-13-5-2-6-14-32/h2-24,26,39-42H,25,27-30H2,1H3/t39-,40+,41+,42+/m1/s1 |
| InChIKey | JGZYTGNYEIQAKY-IYHZCDIESA-N |
| XLogP | 8.53 |
| TPSA | 51.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.79 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |