C35H35NO4 — CID 71486004
7-methyl-3-[(2S,3S,4S,5R)-3,4,5-tris(phenylmethoxy)oxan-2-yl]-1H-indole (PubChem CID 71486004) has the molecular formula C35H35NO4 and a molecular weight of 533.67 g/mol. Its IUPAC name is 7-methyl-3-[(2S,3S,4S,5R)-3,4,5-tris(phenylmethoxy)oxan-2-yl]-1H-indole.
| Compound Name | 7-methyl-3-[(2S,3S,4S,5R)-3,4,5-tris(phenylmethoxy)oxan-2-yl]-1H-indole |
|---|---|
| PubChem CID | 71486004 |
| Molecular Formula | C35H35NO4 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | 7-methyl-3-[(2S,3S,4S,5R)-3,4,5-tris(phenylmethoxy)oxan-2-yl]-1H-indole |
| SMILES | Cc1cccc2c([C@@H]3OC[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)c[nH]c12 |
| InChI | InChI=1S/C35H35NO4/c1-25-12-11-19-29-30(20-36-32(25)29)33-35(39-23-28-17-9-4-10-18-28)34(38-22-27-15-7-3-8-16-27)31(24-40-33)37-21-26-13-5-2-6-14-26/h2-20,31,33-36H,21-24H2,1H3/t31-,33+,34+,35+/m1/s1 |
| InChIKey | WBZHACDOMLLMRO-PEBYJJCOSA-N |
| XLogP | 7.30 |
| TPSA | 52.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |