C33H35NO4 — CID 71524271
(3R,4S,5R)-N-benzyl-3,4,5-tris(phenylmethoxy)oxan-2-amine (PubChem CID 71524271) has the molecular formula C33H35NO4 and a molecular weight of 509.65 g/mol. Its IUPAC name is (3R,4S,5R)-N-benzyl-3,4,5-tris(phenylmethoxy)oxan-2-amine.
| Compound Name | (3R,4S,5R)-N-benzyl-3,4,5-tris(phenylmethoxy)oxan-2-amine |
|---|---|
| PubChem CID | 71524271 |
| Molecular Formula | C33H35NO4 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | (3R,4S,5R)-N-benzyl-3,4,5-tris(phenylmethoxy)oxan-2-amine |
| SMILES | c1ccc(CNC2OCC(OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C33H35NO4/c1-5-13-26(14-6-1)21-34-33-32(37-24-29-19-11-4-12-20-29)31(36-23-28-17-9-3-10-18-28)30(25-38-33)35-22-27-15-7-2-8-16-27/h1-20,30-34H,21-25H2/t30?,31-,32+,33?/m0/s1 |
| InChIKey | DKPQLKNUXACRDI-OKKMUKOFSA-N |
| XLogP | 5.89 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |