C20H20Cl2O3 — CID 10595861
(1S,4R,5R,6R)-7,7-dichloro-4,5-bis(phenylmethoxy)-2-oxabicyclo[4.1.0]heptane (PubChem CID 10595861) has the molecular formula C20H20Cl2O3 and a molecular weight of 379.28 g/mol. Its IUPAC name is (1S,4R,5R,6R)-7,7-dichloro-4,5-bis(phenylmethoxy)-2-oxabicyclo[4.1.0]heptane.
| Compound Name | (1S,4R,5R,6R)-7,7-dichloro-4,5-bis(phenylmethoxy)-2-oxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 10595861 |
| Molecular Formula | C20H20Cl2O3 |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | (1S,4R,5R,6R)-7,7-dichloro-4,5-bis(phenylmethoxy)-2-oxabicyclo[4.1.0]heptane |
| SMILES | ClC1(Cl)[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)CO[C@@H]21 |
| InChI | InChI=1S/C20H20Cl2O3/c21-20(22)17-18(24-12-15-9-5-2-6-10-15)16(13-25-19(17)20)23-11-14-7-3-1-4-8-14/h1-10,16-19H,11-13H2/t16-,17-,18+,19+/m1/s1 |
| InChIKey | QVQNALIXMLUPLQ-YRXWBPOGSA-N |
| XLogP | 4.36 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|