C27H30O5 — CID 25208781
(2R)-2-[(2S,3R,4S)-3,4-bis(phenylmethoxy)oxolan-2-yl]-2-phenylmethoxyethanol (PubChem CID 25208781) has the molecular formula C27H30O5 and a molecular weight of 434.53 g/mol. Its IUPAC name is (2R)-2-[(2S,3R,4S)-3,4-bis(phenylmethoxy)oxolan-2-yl]-2-phenylmethoxyethanol.
| Compound Name | (2R)-2-[(2S,3R,4S)-3,4-bis(phenylmethoxy)oxolan-2-yl]-2-phenylmethoxyethanol |
|---|---|
| PubChem CID | 25208781 |
| Molecular Formula | C27H30O5 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | (2R)-2-[(2S,3R,4S)-3,4-bis(phenylmethoxy)oxolan-2-yl]-2-phenylmethoxyethanol |
| SMILES | OC[C@@H](OCc1ccccc1)[C@@H]1OC[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H30O5/c28-16-24(29-17-21-10-4-1-5-11-21)26-27(31-19-23-14-8-3-9-15-23)25(20-32-26)30-18-22-12-6-2-7-13-22/h1-15,24-28H,16-20H2/t24-,25+,26+,27-/m1/s1 |
| InChIKey | XYURWPJCLGOSKG-LGTXBLIGSA-N |
| XLogP | 4.13 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |