C43H47O9P — CID 170242078
dibenzyl [(2R,3S,4S,5S,6S)-6-[(1R)-2-hydroxy-1-phenylmethoxyethyl]-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl] phosphate (PubChem CID 170242078) has the molecular formula C43H47O9P and a molecular weight of 738.81 g/mol. Its IUPAC name is dibenzyl [(2R,3S,4S,5S,6S)-6-[(1R)-2-hydroxy-1-phenylmethoxyethyl]-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl] phosphate.
| Compound Name | dibenzyl [(2R,3S,4S,5S,6S)-6-[(1R)-2-hydroxy-1-phenylmethoxyethyl]-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl] phosphate |
|---|---|
| PubChem CID | 170242078 |
| Molecular Formula | C43H47O9P |
| Molecular Weight | 738.81 g/mol |
| Exact Mass | 738.30 |
| IUPAC Name | dibenzyl [(2R,3S,4S,5S,6S)-6-[(1R)-2-hydroxy-1-phenylmethoxyethyl]-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl] phosphate |
| SMILES | C[C@H]1[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OP(=O)(OCc2ccccc2)OCc2ccccc2)O[C@@H]1[C@@H](CO)OCc1ccccc1 |
| InChI | InChI=1S/C43H47O9P/c1-33-40(39(27-44)46-28-34-17-7-2-8-18-34)51-43(42(48-30-36-21-11-4-12-22-36)41(33)47-29-35-19-9-3-10-20-35)52-53(45,49-31-37-23-13-5-14-24-37)50-32-38-25-15-6-16-26-38/h2-26,33,39-44H,27-32H2,1H3/t33-,39-,40+,41+,42+,43-/m1/s1 |
| InChIKey | PRUDRWWTDRUOKS-CHVNTDFHSA-N |
| XLogP | 8.65 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.81 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|